C11H24O3Si2 — CID 87359143
5-[dimethyl(trimethylsilyloxy)silyl]-2-methylidenepentanoic acid (PubChem CID 87359143) has the molecular formula C11H24O3Si2 and a molecular weight of 260.48 g/mol. Its IUPAC name is 5-[dimethyl(trimethylsilyloxy)silyl]-2-methylidenepentanoic acid.
| Compound Name | 5-[dimethyl(trimethylsilyloxy)silyl]-2-methylidenepentanoic acid |
|---|---|
| PubChem CID | 87359143 |
| Molecular Formula | C11H24O3Si2 |
| Molecular Weight | 260.48 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-[dimethyl(trimethylsilyloxy)silyl]-2-methylidenepentanoic acid |
| SMILES | C=C(CCC[Si](C)(C)O[Si](C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H24O3Si2/c1-10(11(12)13)8-7-9-16(5,6)14-15(2,3)4/h1,7-9H2,2-6H3,(H,12,13) |
| InChIKey | WMFVVGZJHRJYBK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|