C18H34O5Si2 — CID 67764331
2-cyclohexyl-3-[3-[dimethyl(trimethylsilyloxy)silyl]propyl]but-2-enedioic acid (PubChem CID 67764331) has the molecular formula C18H34O5Si2 and a molecular weight of 386.64 g/mol. Its IUPAC name is 2-cyclohexyl-3-[3-[dimethyl(trimethylsilyloxy)silyl]propyl]but-2-enedioic acid.
| Compound Name | 2-cyclohexyl-3-[3-[dimethyl(trimethylsilyloxy)silyl]propyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 67764331 |
| Molecular Formula | C18H34O5Si2 |
| Molecular Weight | 386.64 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-cyclohexyl-3-[3-[dimethyl(trimethylsilyloxy)silyl]propyl]but-2-enedioic acid |
| SMILES | C[Si](C)(C)O[Si](C)(C)CCCC(C(=O)O)=C(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C18H34O5Si2/c1-24(2,3)23-25(4,5)13-9-12-15(17(19)20)16(18(21)22)14-10-7-6-8-11-14/h14H,6-13H2,1-5H3,(H,19,20)(H,21,22) |
| InChIKey | HNEJHEDDEUSNGN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|