C16H44O5Si7 — CID 173288745
2-methylidene-6-tris(trimethylsilyloxysilyl)silylhexanoic acid (PubChem CID 173288745) has the molecular formula C16H44O5Si7 and a molecular weight of 513.13 g/mol. Its IUPAC name is 2-methylidene-6-tris(trimethylsilyloxysilyl)silylhexanoic acid.
| Compound Name | 2-methylidene-6-tris(trimethylsilyloxysilyl)silylhexanoic acid |
|---|---|
| PubChem CID | 173288745 |
| Molecular Formula | C16H44O5Si7 |
| Molecular Weight | 513.13 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 2-methylidene-6-tris(trimethylsilyloxysilyl)silylhexanoic acid |
| SMILES | C=C(CCCC[Si]([SiH2]O[Si](C)(C)C)([SiH2]O[Si](C)(C)C)[SiH2]O[Si](C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H44O5Si7/c1-15(16(17)18)13-11-12-14-28(22-19-25(2,3)4,23-20-26(5,6)7)24-21-27(8,9)10/h1,11-14,22-24H2,2-10H3,(H,17,18) |
| InChIKey | JLQREJOFEAGNEH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.13 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|