C16H22F10O2Si — CID 19816645
6-[methyl-bis(3,3,4,4,4-pentafluorobutyl)silyl]-2-methylidenehexanoic acid (PubChem CID 19816645) has the molecular formula C16H22F10O2Si and a molecular weight of 464.42 g/mol. Its IUPAC name is 6-[methyl-bis(3,3,4,4,4-pentafluorobutyl)silyl]-2-methylidenehexanoic acid.
| Compound Name | 6-[methyl-bis(3,3,4,4,4-pentafluorobutyl)silyl]-2-methylidenehexanoic acid |
|---|---|
| PubChem CID | 19816645 |
| Molecular Formula | C16H22F10O2Si |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 6-[methyl-bis(3,3,4,4,4-pentafluorobutyl)silyl]-2-methylidenehexanoic acid |
| SMILES | C=C(CCCC[Si](C)(CCC(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H22F10O2Si/c1-11(12(27)28)5-3-4-8-29(2,9-6-13(17,18)15(21,22)23)10-7-14(19,20)16(24,25)26/h1,3-10H2,2H3,(H,27,28) |
| InChIKey | FIBXEBRRPIGPLQ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|