C19H14F21NO2S — CID 54396627
5-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecanethioylamino)-2-methylidenepentanoic acid (PubChem CID 54396627) has the molecular formula C19H14F21NO2S and a molecular weight of 719.35 g/mol. Its IUPAC name is 5-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecanethioylamino)-2-methylidenepentanoic acid.
| Compound Name | 5-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecanethioylamino)-2-methylidenepentanoic acid |
|---|---|
| PubChem CID | 54396627 |
| Molecular Formula | C19H14F21NO2S |
| Molecular Weight | 719.35 g/mol |
| Exact Mass | 719.04 |
| IUPAC Name | 5-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecanethioylamino)-2-methylidenepentanoic acid |
| SMILES | C=C(CCCNC(=S)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C19H14F21NO2S/c1-7(9(42)43)3-2-6-41-8(44)4-5-10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)16(32,33)17(34,35)18(36,37)19(38,39)40/h1-6H2,(H,41,44)(H,42,43) |
| InChIKey | VKKULXAJXQJZCC-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.35 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|