C20H15F21O4 — CID 161318956
ethyl prop-2-enoate;5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-henicosafluoro-2-methylidenetetradecanoic acid (PubChem CID 161318956) has the molecular formula C20H15F21O4 and a molecular weight of 718.29 g/mol. Its IUPAC name is ethyl prop-2-enoate;5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-henicosafluoro-2-methylidenetetradecanoic acid.
| Compound Name | ethyl prop-2-enoate;5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-henicosafluoro-2-methylidenetetradecanoic acid |
|---|---|
| PubChem CID | 161318956 |
| Molecular Formula | C20H15F21O4 |
| Molecular Weight | 718.29 g/mol |
| Exact Mass | 718.06 |
| IUPAC Name | ethyl prop-2-enoate;5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-henicosafluoro-2-methylidenetetradecanoic acid |
| SMILES | C=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O.C=CC(=O)OCC |
| InChI | InChI=1S/C15H7F21O2.C5H8O2/c1-4(5(37)38)2-3-6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)12(28,29)13(30,31)14(32,33)15(34,35)36;1-3-5(6)7-4-2/h1-3H2,(H,37,38);3H,1,4H2,2H3 |
| InChIKey | VJWORQOJLZTCMV-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.29 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|