C15H9F19O2 — CID 118223460
5,5,6,6,7,7,8,8,9,9,11,11,12,12,13,13,14,14,14-nonadecafluoro-2-methylidenetetradecanoic acid (PubChem CID 118223460) has the molecular formula C15H9F19O2 and a molecular weight of 582.20 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,11,11,12,12,13,13,14,14,14-nonadecafluoro-2-methylidenetetradecanoic acid.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,11,11,12,12,13,13,14,14,14-nonadecafluoro-2-methylidenetetradecanoic acid |
|---|---|
| PubChem CID | 118223460 |
| Molecular Formula | C15H9F19O2 |
| Molecular Weight | 582.20 g/mol |
| Exact Mass | 582.03 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,11,11,12,12,13,13,14,14,14-nonadecafluoro-2-methylidenetetradecanoic acid |
| SMILES | C=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H9F19O2/c1-5(6(35)36)2-3-7(16,17)10(22,23)13(28,29)11(24,25)8(18,19)4-9(20,21)12(26,27)14(30,31)15(32,33)34/h1-4H2,(H,35,36) |
| InChIKey | ZPIDFGNQFHJEGC-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.20 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|