C9H7F11O2 — CID 18469837
5,5,6,6,7,7,8,8,9,9,9-undecafluorononanoic acid (PubChem CID 18469837) has the molecular formula C9H7F11O2 and a molecular weight of 356.13 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,9-undecafluorononanoic acid.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,9-undecafluorononanoic acid |
|---|---|
| PubChem CID | 18469837 |
| Molecular Formula | C9H7F11O2 |
| Molecular Weight | 356.13 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,9-undecafluorononanoic acid |
| SMILES | O=C(O)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F11O2/c10-5(11,3-1-2-4(21)22)6(12,13)7(14,15)8(16,17)9(18,19)20/h1-3H2,(H,21,22) |
| InChIKey | PSELATVJUWEPCC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.13 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|