C13H15F11O2 — CID 101432379
9,9,10,10,11,11,12,12,13,13,13-undecafluorotridecanoic acid (PubChem CID 101432379) has the molecular formula C13H15F11O2 and a molecular weight of 412.24 g/mol. Its IUPAC name is 9,9,10,10,11,11,12,12,13,13,13-undecafluorotridecanoic acid.
| Compound Name | 9,9,10,10,11,11,12,12,13,13,13-undecafluorotridecanoic acid |
|---|---|
| PubChem CID | 101432379 |
| Molecular Formula | C13H15F11O2 |
| Molecular Weight | 412.24 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 9,9,10,10,11,11,12,12,13,13,13-undecafluorotridecanoic acid |
| SMILES | O=C(O)CCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H15F11O2/c14-9(15,7-5-3-1-2-4-6-8(25)26)10(16,17)11(18,19)12(20,21)13(22,23)24/h1-7H2,(H,25,26) |
| InChIKey | HENXOGPFITTYRE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.24 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|