C15H14F16O2 — CID 88617652
2,3,3,4,4,5,5-heptafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)undecanoic acid (PubChem CID 88617652) has the molecular formula C15H14F16O2 and a molecular weight of 530.24 g/mol. Its IUPAC name is 2,3,3,4,4,5,5-heptafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)undecanoic acid.
| Compound Name | 2,3,3,4,4,5,5-heptafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)undecanoic acid |
|---|---|
| PubChem CID | 88617652 |
| Molecular Formula | C15H14F16O2 |
| Molecular Weight | 530.24 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | 2,3,3,4,4,5,5-heptafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)undecanoic acid |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(C(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H14F16O2/c1-2-3-4-5-6-8(16,17)10(19,20)11(21,22)9(18,7(32)33)12(23,24)13(25,26)14(27,28)15(29,30)31/h2-6H2,1H3,(H,32,33) |
| InChIKey | ABLVSRYPWQXOPI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.24 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|