C11H13F11 — CID 98452289
1,1,1,2,2,3,3,4,4,5,5-undecafluoroundecane (PubChem CID 98452289) has the molecular formula C11H13F11 and a molecular weight of 354.20 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5-undecafluoroundecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5-undecafluoroundecane |
|---|---|
| PubChem CID | 98452289 |
| Molecular Formula | C11H13F11 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5-undecafluoroundecane |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F11/c1-2-3-4-5-6-7(12,13)8(14,15)9(16,17)10(18,19)11(20,21)22/h2-6H2,1H3 |
| InChIKey | JNSNOMBEZFGTQM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|