C13H20F8 — CID 121404861
3,3,4,4,5,5,6,6-octafluorotridecane (PubChem CID 121404861) has the molecular formula C13H20F8 and a molecular weight of 328.29 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octafluorotridecane.
| Compound Name | 3,3,4,4,5,5,6,6-octafluorotridecane |
|---|---|
| PubChem CID | 121404861 |
| Molecular Formula | C13H20F8 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octafluorotridecane |
| SMILES | CCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC |
| InChI | InChI=1S/C13H20F8/c1-3-5-6-7-8-9-11(16,17)13(20,21)12(18,19)10(14,15)4-2/h3-9H2,1-2H3 |
| InChIKey | KDUAITXEVVZHFK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|