C18H26F12O — CID 121403458
9,9,10,10,11,11,12,12,13,13,14,14-dodecafluorooctadecan-1-ol (PubChem CID 121403458) has the molecular formula C18H26F12O and a molecular weight of 486.38 g/mol. Its IUPAC name is 9,9,10,10,11,11,12,12,13,13,14,14-dodecafluorooctadecan-1-ol.
| Compound Name | 9,9,10,10,11,11,12,12,13,13,14,14-dodecafluorooctadecan-1-ol |
|---|---|
| PubChem CID | 121403458 |
| Molecular Formula | C18H26F12O |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 9,9,10,10,11,11,12,12,13,13,14,14-dodecafluorooctadecan-1-ol |
| SMILES | CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCCCCCO |
| InChI | InChI=1S/C18H26F12O/c1-2-3-10-13(19,20)15(23,24)17(27,28)18(29,30)16(25,26)14(21,22)11-8-6-4-5-7-9-12-31/h31H,2-12H2,1H3 |
| InChIKey | FZBQPHJVFLSQQF-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|