C13H16F12O — CID 121403329
4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorotridecan-1-ol (PubChem CID 121403329) has the molecular formula C13H16F12O and a molecular weight of 416.25 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorotridecan-1-ol.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorotridecan-1-ol |
|---|---|
| PubChem CID | 121403329 |
| Molecular Formula | C13H16F12O |
| Molecular Weight | 416.25 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorotridecan-1-ol |
| SMILES | CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCO |
| InChI | InChI=1S/C13H16F12O/c1-2-3-5-8(14,15)10(18,19)12(22,23)13(24,25)11(20,21)9(16,17)6-4-7-26/h26H,2-7H2,1H3 |
| InChIKey | JMMNTXLPZXNGJP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.25 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|