C13H13F15O — CID 54057329
7,7,8,8,9,9,10,10,11,12,12,12-dodecafluoro-11-(trifluoromethyl)dodecan-1-ol (PubChem CID 54057329) has the molecular formula C13H13F15O and a molecular weight of 470.22 g/mol. Its IUPAC name is 7,7,8,8,9,9,10,10,11,12,12,12-dodecafluoro-11-(trifluoromethyl)dodecan-1-ol.
| Compound Name | 7,7,8,8,9,9,10,10,11,12,12,12-dodecafluoro-11-(trifluoromethyl)dodecan-1-ol |
|---|---|
| PubChem CID | 54057329 |
| Molecular Formula | C13H13F15O |
| Molecular Weight | 470.22 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 7,7,8,8,9,9,10,10,11,12,12,12-dodecafluoro-11-(trifluoromethyl)dodecan-1-ol |
| SMILES | OCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H13F15O/c14-7(15,5-3-1-2-4-6-29)9(17,18)11(21,22)10(19,20)8(16,12(23,24)25)13(26,27)28/h29H,1-6H2 |
| InChIKey | LXDYZYHFMMEOTN-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.22 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|