C17H22F12O — CID 121403408
(E)-5,5,6,6,7,7,8,8,9,9,10,10-dodecafluoroheptadec-15-en-1-ol (PubChem CID 121403408) has the molecular formula C17H22F12O and a molecular weight of 470.34 g/mol. Its IUPAC name is (E)-5,5,6,6,7,7,8,8,9,9,10,10-dodecafluoroheptadec-15-en-1-ol.
| Compound Name | (E)-5,5,6,6,7,7,8,8,9,9,10,10-dodecafluoroheptadec-15-en-1-ol |
|---|---|
| PubChem CID | 121403408 |
| Molecular Formula | C17H22F12O |
| Molecular Weight | 470.34 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (E)-5,5,6,6,7,7,8,8,9,9,10,10-dodecafluoroheptadec-15-en-1-ol |
| SMILES | C/C=C/CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCO |
| InChI | InChI=1S/C17H22F12O/c1-2-3-4-5-6-9-12(18,19)14(22,23)16(26,27)17(28,29)15(24,25)13(20,21)10-7-8-11-30/h2-3,30H,4-11H2,1H3/b3-2+ |
| InChIKey | OXEYXSVRQYYCGF-NSCUHMNNSA-N |
| XLogP | 7.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.34 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|