C14H16F12O — CID 121403327
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotetradec-13-en-1-ol (PubChem CID 121403327) has the molecular formula C14H16F12O and a molecular weight of 428.26 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotetradec-13-en-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotetradec-13-en-1-ol |
|---|---|
| PubChem CID | 121403327 |
| Molecular Formula | C14H16F12O |
| Molecular Weight | 428.26 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotetradec-13-en-1-ol |
| SMILES | C=CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CO |
| InChI | InChI=1S/C14H16F12O/c1-2-3-4-5-6-7-9(15,16)11(19,20)13(23,24)14(25,26)12(21,22)10(17,18)8-27/h2,27H,1,3-8H2 |
| InChIKey | NMTAUDWOIMXFHJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.26 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|