C9H9F9 — CID 88655543
6,6,7,7,8,8,9,9,9-nonafluoronon-1-ene (PubChem CID 88655543) has the molecular formula C9H9F9 and a molecular weight of 288.15 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,9-nonafluoronon-1-ene.
| Compound Name | 6,6,7,7,8,8,9,9,9-nonafluoronon-1-ene |
|---|---|
| PubChem CID | 88655543 |
| Molecular Formula | C9H9F9 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 6,6,7,7,8,8,9,9,9-nonafluoronon-1-ene |
| SMILES | C=CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F9/c1-2-3-4-5-6(10,11)7(12,13)8(14,15)9(16,17)18/h2H,1,3-5H2 |
| InChIKey | AXTSCPOCHTUQQD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|