C32H15F51Si — CID 101381950
ethenyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane (PubChem CID 101381950) has the molecular formula C32H15F51Si and a molecular weight of 1396.46 g/mol. Its IUPAC name is ethenyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane.
| Compound Name | ethenyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane |
|---|---|
| PubChem CID | 101381950 |
| Molecular Formula | C32H15F51Si |
| Molecular Weight | 1396.46 g/mol |
| Exact Mass | 1396.01 |
| IUPAC Name | ethenyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane |
| SMILES | C=C[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H15F51Si/c1-2-84(6-3-9(33,34)12(39,40)15(45,46)18(51,52)21(57,58)24(63,64)27(69,70)30(75,76)77,7-4-10(35,36)13(41,42)16(47,48)19(53,54)22(59,60)25(65,66)28(71,72)31(78,79)80)8-5-11(37,38)14(43,44)17(49,50)20(55,56)23(61,62)26(67,68)29(73,74)32(81,82)83/h2H,1,3-8H2 |
| InChIKey | ZKMSFGMVOLHCEV-UHFFFAOYSA-N |
| XLogP | 19.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 28 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1396.46 |
| LogP ≤ 5 | 19.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|