C13H12ClF17Si — CID 59112310
chloro-bis(3,3,3-trifluoropropyl)-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silane (PubChem CID 59112310) has the molecular formula C13H12ClF17Si and a molecular weight of 554.74 g/mol. Its IUPAC name is chloro-bis(3,3,3-trifluoropropyl)-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silane.
| Compound Name | chloro-bis(3,3,3-trifluoropropyl)-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silane |
|---|---|
| PubChem CID | 59112310 |
| Molecular Formula | C13H12ClF17Si |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.01 |
| IUPAC Name | chloro-bis(3,3,3-trifluoropropyl)-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silane |
| SMILES | FC(F)(F)CC[Si](Cl)(CCC(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H12ClF17Si/c14-32(5-2-8(17,18)19,6-3-9(20,21)22)4-1-7(15,16)10(23,24)11(25,26)12(27,28)13(29,30)31/h1-6H2 |
| InChIKey | ZFCDQORUBFQPDY-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|