C11H16F11NSi — CID 175854571
N-[dimethyl(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silyl]-N-methylmethanamine (PubChem CID 175854571) has the molecular formula C11H16F11NSi and a molecular weight of 399.32 g/mol. Its IUPAC name is N-[dimethyl(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silyl]-N-methylmethanamine.
| Compound Name | N-[dimethyl(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 175854571 |
| Molecular Formula | C11H16F11NSi |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-[dimethyl(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)silyl]-N-methylmethanamine |
| SMILES | CN(C)[Si](C)(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H16F11NSi/c1-23(2)24(3,4)6-5-7(12,13)8(14,15)9(16,17)10(18,19)11(20,21)22/h5-6H2,1-4H3 |
| InChIKey | ARZFFLJBVSARHV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|