C15H13F18N3O3Si — CID 175690734
N-[bis[methyl-(2,2,2-trifluoroacetyl)amino]-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silyl]-2,2,2-trifluoro-N-methylacetamide (PubChem CID 175690734) has the molecular formula C15H13F18N3O3Si and a molecular weight of 653.34 g/mol. Its IUPAC name is N-[bis[methyl-(2,2,2-trifluoroacetyl)amino]-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silyl]-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | N-[bis[methyl-(2,2,2-trifluoroacetyl)amino]-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silyl]-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 175690734 |
| Molecular Formula | C15H13F18N3O3Si |
| Molecular Weight | 653.34 g/mol |
| Exact Mass | 653.04 |
| IUPAC Name | N-[bis[methyl-(2,2,2-trifluoroacetyl)amino]-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silyl]-2,2,2-trifluoro-N-methylacetamide |
| SMILES | CN(C(=O)C(F)(F)F)[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(N(C)C(=O)C(F)(F)F)N(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H13F18N3O3Si/c1-34(6(37)10(18,19)20)40(35(2)7(38)11(21,22)23,36(3)8(39)12(24,25)26)5-4-9(16,17)13(27,28)14(29,30)15(31,32)33/h4-5H2,1-3H3 |
| InChIKey | YDTOJJGYMLGTKS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|