C29H24F39NSi — CID 122383089
N,N-dimethyl-3-[tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silyl]propan-1-amine (PubChem CID 122383089) has the molecular formula C29H24F39NSi and a molecular weight of 1155.53 g/mol. Its IUPAC name is N,N-dimethyl-3-[tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silyl]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silyl]propan-1-amine |
|---|---|
| PubChem CID | 122383089 |
| Molecular Formula | C29H24F39NSi |
| Molecular Weight | 1155.53 g/mol |
| Exact Mass | 1155.11 |
| IUPAC Name | N,N-dimethyl-3-[tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silyl]propan-1-amine |
| SMILES | CN(C)CCC[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H24F39NSi/c1-69(2)7-3-8-70(9-4-12(30,31)15(36,37)18(42,43)21(48,49)24(54,55)27(60,61)62,10-5-13(32,33)16(38,39)19(44,45)22(50,51)25(56,57)28(63,64)65)11-6-14(34,35)17(40,41)20(46,47)23(52,53)26(58,59)29(66,67)68/h3-11H2,1-2H3 |
| InChIKey | SUWHIQYOXQMPAM-UHFFFAOYSA-N |
| XLogP | 15.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1155.53 |
| LogP ≤ 5 | 15.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|