C30H27F39NSi+ — CID 122383090
trimethyl-[3-[tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silyl]propyl]azanium (PubChem CID 122383090) has the molecular formula C30H27F39NSi+ and a molecular weight of 1170.56 g/mol. Its IUPAC name is trimethyl-[3-[tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silyl]propyl]azanium.
| Compound Name | trimethyl-[3-[tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silyl]propyl]azanium |
|---|---|
| PubChem CID | 122383090 |
| Molecular Formula | C30H27F39NSi+ |
| Molecular Weight | 1170.56 g/mol |
| Exact Mass | 1170.13 |
| IUPAC Name | trimethyl-[3-[tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silyl]propyl]azanium |
| SMILES | C[N+](C)(C)CCC[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H27F39NSi/c1-70(2,3)8-4-9-71(10-5-13(31,32)16(37,38)19(43,44)22(49,50)25(55,56)28(61,62)63,11-6-14(33,34)17(39,40)20(45,46)23(51,52)26(57,58)29(64,65)66)12-7-15(35,36)18(41,42)21(47,48)24(53,54)27(59,60)30(67,68)69/h4-12H2,1-3H3/q+1 |
| InChIKey | HVCCYDXDWWKAHW-UHFFFAOYSA-N |
| XLogP | 15.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 25 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1170.56 |
| LogP ≤ 5 | 15.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|