C9H9F13O3Si — CID 146679665
dihydroxy-methoxy-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane (PubChem CID 146679665) has the molecular formula C9H9F13O3Si and a molecular weight of 440.23 g/mol. Its IUPAC name is dihydroxy-methoxy-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane.
| Compound Name | dihydroxy-methoxy-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
|---|---|
| PubChem CID | 146679665 |
| Molecular Formula | C9H9F13O3Si |
| Molecular Weight | 440.23 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | dihydroxy-methoxy-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| SMILES | CO[Si](O)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F13O3Si/c1-25-26(23,24)3-2-4(10,11)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)22/h23-24H,2-3H2,1H3 |
| InChIKey | YEYHTOYFIUTELV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.23 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|