C15H18F16OSi — CID 59112316
methoxy-propyl-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-(3,3,3-trifluoropropyl)silane (PubChem CID 59112316) has the molecular formula C15H18F16OSi and a molecular weight of 546.36 g/mol. Its IUPAC name is methoxy-propyl-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-(3,3,3-trifluoropropyl)silane.
| Compound Name | methoxy-propyl-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 59112316 |
| Molecular Formula | C15H18F16OSi |
| Molecular Weight | 546.36 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | methoxy-propyl-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-(3,3,3-trifluoropropyl)silane |
| SMILES | CCC[Si](CCC(F)(F)F)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC |
| InChI | InChI=1S/C15H18F16OSi/c1-3-6-33(32-2,8-5-10(18,19)20)7-4-9(16,17)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)31/h3-8H2,1-2H3 |
| InChIKey | NRUDULHLOMOAAY-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.36 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|