C10H17F7OSi — CID 59112306
diethyl-(3,3,4,4,5,5,5-heptafluoropentyl)-methoxysilane (PubChem CID 59112306) has the molecular formula C10H17F7OSi and a molecular weight of 314.32 g/mol. Its IUPAC name is diethyl-(3,3,4,4,5,5,5-heptafluoropentyl)-methoxysilane.
| Compound Name | diethyl-(3,3,4,4,5,5,5-heptafluoropentyl)-methoxysilane |
|---|---|
| PubChem CID | 59112306 |
| Molecular Formula | C10H17F7OSi |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | diethyl-(3,3,4,4,5,5,5-heptafluoropentyl)-methoxysilane |
| SMILES | CC[Si](CC)(CCC(F)(F)C(F)(F)C(F)(F)F)OC |
| InChI | InChI=1S/C10H17F7OSi/c1-4-19(5-2,18-3)7-6-8(11,12)9(13,14)10(15,16)17/h4-7H2,1-3H3 |
| InChIKey | WRQRRUDWLMWEAT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|