C12H19F9OSi — CID 132934764
triethyl(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)silane (PubChem CID 132934764) has the molecular formula C12H19F9OSi and a molecular weight of 378.35 g/mol. Its IUPAC name is triethyl(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)silane.
| Compound Name | triethyl(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)silane |
|---|---|
| PubChem CID | 132934764 |
| Molecular Formula | C12H19F9OSi |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | triethyl(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)silane |
| SMILES | CC[Si](CC)(CC)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H19F9OSi/c1-4-23(5-2,6-3)22-8-7-9(13,14)10(15,16)11(17,18)12(19,20)21/h4-8H2,1-3H3 |
| InChIKey | PYDDHBSMSKRJGS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|