C21H21F17O3Si — CID 139931305
benzyl-diethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)silane (PubChem CID 139931305) has the molecular formula C21H21F17O3Si and a molecular weight of 672.45 g/mol. Its IUPAC name is benzyl-diethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)silane.
| Compound Name | benzyl-diethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)silane |
|---|---|
| PubChem CID | 139931305 |
| Molecular Formula | C21H21F17O3Si |
| Molecular Weight | 672.45 g/mol |
| Exact Mass | 672.10 |
| IUPAC Name | benzyl-diethoxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)silane |
| SMILES | CCO[Si](Cc1ccccc1)(OCC)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H21F17O3Si/c1-3-39-42(40-4-2,12-13-8-6-5-7-9-13)41-11-10-14(22,23)15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)20(34,35)21(36,37)38/h5-9H,3-4,10-12H2,1-2H3 |
| InChIKey | WRMXRDKCXQQETJ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.45 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|