C17H15F13 — CID 162538587
6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundecylbenzene (PubChem CID 162538587) has the molecular formula C17H15F13 and a molecular weight of 466.28 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundecylbenzene.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundecylbenzene |
|---|---|
| PubChem CID | 162538587 |
| Molecular Formula | C17H15F13 |
| Molecular Weight | 466.28 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoroundecylbenzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCCc1ccccc1 |
| InChI | InChI=1S/C17H15F13/c18-12(19,10-6-2-5-9-11-7-3-1-4-8-11)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h1,3-4,7-8H,2,5-6,9-10H2 |
| InChIKey | IRASZGNZVBGDPN-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.28 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|