C21H23F13O2 — CID 162348412
8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluoro-6-(2-phenylethyl)tridecane-1,6-diol (PubChem CID 162348412) has the molecular formula C21H23F13O2 and a molecular weight of 554.39 g/mol. Its IUPAC name is 8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluoro-6-(2-phenylethyl)tridecane-1,6-diol.
| Compound Name | 8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluoro-6-(2-phenylethyl)tridecane-1,6-diol |
|---|---|
| PubChem CID | 162348412 |
| Molecular Formula | C21H23F13O2 |
| Molecular Weight | 554.39 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluoro-6-(2-phenylethyl)tridecane-1,6-diol |
| SMILES | OCCCCCC(O)(CCc1ccccc1)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H23F13O2/c22-16(23,17(24,25)18(26,27)19(28,29)20(30,31)21(32,33)34)13-15(36,10-5-2-6-12-35)11-9-14-7-3-1-4-8-14/h1,3-4,7-8,35-36H,2,5-6,9-13H2 |
| InChIKey | LJWNYUHVBKRBQT-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.39 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|