C31H23F34N — CID 10653679
N-benzyl-5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-N-(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecyl)dodecan-1-amine (PubChem CID 10653679) has the molecular formula C31H23F34N and a molecular weight of 1055.46 g/mol. Its IUPAC name is N-benzyl-5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-N-(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecyl)dodecan-1-amine.
| Compound Name | N-benzyl-5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-N-(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecyl)dodecan-1-amine |
|---|---|
| PubChem CID | 10653679 |
| Molecular Formula | C31H23F34N |
| Molecular Weight | 1055.46 g/mol |
| Exact Mass | 1055.13 |
| IUPAC Name | N-benzyl-5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluoro-N-(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heptadecafluorododecyl)dodecan-1-amine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCN(CCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)Cc1ccccc1 |
| InChI | InChI=1S/C31H23F34N/c32-16(33,18(36,37)20(40,41)22(44,45)24(48,49)26(52,53)28(56,57)30(60,61)62)10-4-6-12-66(14-15-8-2-1-3-9-15)13-7-5-11-17(34,35)19(38,39)21(42,43)23(46,47)25(50,51)27(54,55)29(58,59)31(63,64)65/h1-3,8-9H,4-7,10-14H2 |
| InChIKey | ISJZBQVDIIUGBW-UHFFFAOYSA-N |
| XLogP | 14.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1055.46 |
| LogP ≤ 5 | 14.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|