C24H23F18NOS — CID 102256702
O-(1-phenylpropan-2-yl) N,N-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)carbamothioate (PubChem CID 102256702) has the molecular formula C24H23F18NOS and a molecular weight of 715.48 g/mol. Its IUPAC name is O-(1-phenylpropan-2-yl) N,N-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)carbamothioate.
| Compound Name | O-(1-phenylpropan-2-yl) N,N-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)carbamothioate |
|---|---|
| PubChem CID | 102256702 |
| Molecular Formula | C24H23F18NOS |
| Molecular Weight | 715.48 g/mol |
| Exact Mass | 715.12 |
| IUPAC Name | O-(1-phenylpropan-2-yl) N,N-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)carbamothioate |
| SMILES | CC(Cc1ccccc1)OC(=S)N(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H23F18NOS/c1-14(13-15-7-3-2-4-8-15)44-16(45)43(11-5-9-17(25,26)19(29,30)21(33,34)23(37,38)39)12-6-10-18(27,28)20(31,32)22(35,36)24(40,41)42/h2-4,7-8,14H,5-6,9-13H2,1H3 |
| InChIKey | KNECPJYAXRXTGQ-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.48 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|