C28H32F7NO6 — CID 22232950
2-ethoxy-3-[4-[2-[5,5,6,6,7,7,7-heptafluoroheptyl(phenylmethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22232950) has the molecular formula C28H32F7NO6 and a molecular weight of 611.55 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[5,5,6,6,7,7,7-heptafluoroheptyl(phenylmethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[5,5,6,6,7,7,7-heptafluoroheptyl(phenylmethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232950 |
| Molecular Formula | C28H32F7NO6 |
| Molecular Weight | 611.55 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[5,5,6,6,7,7,7-heptafluoroheptyl(phenylmethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC(F)(F)C(F)(F)C(F)(F)F)C(=O)OCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H32F7NO6/c1-2-40-23(24(37)38)18-20-10-12-22(13-11-20)41-17-16-36(25(39)42-19-21-8-4-3-5-9-21)15-7-6-14-26(29,30)27(31,32)28(33,34)35/h3-5,8-13,23H,2,6-7,14-19H2,1H3,(H,37,38) |
| InChIKey | UKEQZXOYCMZLEL-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.55 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|