C31H36FNO7 — CID 22233021
2-ethoxy-3-[4-[2-[(4-fluorophenyl)methoxycarbonyl-(3-phenylmethoxypropyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22233021) has the molecular formula C31H36FNO7 and a molecular weight of 553.63 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(4-fluorophenyl)methoxycarbonyl-(3-phenylmethoxypropyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(4-fluorophenyl)methoxycarbonyl-(3-phenylmethoxypropyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233021 |
| Molecular Formula | C31H36FNO7 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(4-fluorophenyl)methoxycarbonyl-(3-phenylmethoxypropyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOCc2ccccc2)C(=O)OCc2ccc(F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C31H36FNO7/c1-2-38-29(30(34)35)21-24-11-15-28(16-12-24)39-20-18-33(17-6-19-37-22-25-7-4-3-5-8-25)31(36)40-23-26-9-13-27(32)14-10-26/h3-5,7-16,29H,2,6,17-23H2,1H3,(H,34,35) |
| InChIKey | RGAWUOOEWSGJDV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|