C28H39NO6 — CID 12001958
(2R)-2-ethoxy-3-[4-[2-[heptyl(phenylmethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 12001958) has the molecular formula C28H39NO6 and a molecular weight of 485.62 g/mol. Its IUPAC name is (2R)-2-ethoxy-3-[4-[2-[heptyl(phenylmethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | (2R)-2-ethoxy-3-[4-[2-[heptyl(phenylmethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 12001958 |
| Molecular Formula | C28H39NO6 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | (2R)-2-ethoxy-3-[4-[2-[heptyl(phenylmethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCCCN(CCOc1ccc(C[C@@H](OCC)C(=O)O)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H39NO6/c1-3-5-6-7-11-18-29(28(32)35-22-24-12-9-8-10-13-24)19-20-34-25-16-14-23(15-17-25)21-26(27(30)31)33-4-2/h8-10,12-17,26H,3-7,11,18-22H2,1-2H3,(H,30,31)/t26-/m1/s1 |
| InChIKey | FSFHBSDBNQTENE-AREMUKBSSA-N |
| XLogP | 5.71 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|