C24H36F3NO6 — CID 22234588
2-ethoxy-3-[4-[2-[octyl(2,2,2-trifluoroethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22234588) has the molecular formula C24H36F3NO6 and a molecular weight of 491.55 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[octyl(2,2,2-trifluoroethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[octyl(2,2,2-trifluoroethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22234588 |
| Molecular Formula | C24H36F3NO6 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[octyl(2,2,2-trifluoroethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C24H36F3NO6/c1-3-5-6-7-8-9-14-28(23(31)34-18-24(25,26)27)15-16-33-20-12-10-19(11-13-20)17-21(22(29)30)32-4-2/h10-13,21H,3-9,14-18H2,1-2H3,(H,29,30) |
| InChIKey | LYMFYIGJNOTIRT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|