C27H36FNO7 — CID 22232901
2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-propoxycarbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22232901) has the molecular formula C27H36FNO7 and a molecular weight of 505.58 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-propoxycarbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-propoxycarbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232901 |
| Molecular Formula | C27H36FNO7 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-propoxycarbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCOC(=O)N(CCCCOc1ccc(F)cc1)CCOc1ccc(CC(OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C27H36FNO7/c1-3-17-36-27(32)29(15-5-6-18-34-24-13-9-22(28)10-14-24)16-19-35-23-11-7-21(8-12-23)20-25(26(30)31)33-4-2/h7-14,25H,3-6,15-20H2,1-2H3,(H,30,31) |
| InChIKey | WMBQXGQOCQGSIP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|