C33H40FNO7 — CID 22231529
2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-(4-propan-2-ylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22231529) has the molecular formula C33H40FNO7 and a molecular weight of 581.68 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-(4-propan-2-ylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-(4-propan-2-ylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231529 |
| Molecular Formula | C33H40FNO7 |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[4-(4-fluorophenoxy)butyl-(4-propan-2-ylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCOc2ccc(F)cc2)C(=O)Oc2ccc(C(C)C)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C33H40FNO7/c1-4-39-31(32(36)37)23-25-7-13-28(14-8-25)41-22-20-35(19-5-6-21-40-29-17-11-27(34)12-18-29)33(38)42-30-15-9-26(10-16-30)24(2)3/h7-18,24,31H,4-6,19-23H2,1-3H3,(H,36,37) |
| InChIKey | JLLDJOOTPGKKPJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|