C29H32FNO6S — CID 22232816
2-ethoxy-3-[4-[2-[(4-fluorophenoxy)carbonyl-(3-phenylsulfanylpropyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22232816) has the molecular formula C29H32FNO6S and a molecular weight of 541.64 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(4-fluorophenoxy)carbonyl-(3-phenylsulfanylpropyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(4-fluorophenoxy)carbonyl-(3-phenylsulfanylpropyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232816 |
| Molecular Formula | C29H32FNO6S |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(4-fluorophenoxy)carbonyl-(3-phenylsulfanylpropyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCSc2ccccc2)C(=O)Oc2ccc(F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C29H32FNO6S/c1-2-35-27(28(32)33)21-22-9-13-24(14-10-22)36-19-18-31(17-6-20-38-26-7-4-3-5-8-26)29(34)37-25-15-11-23(30)12-16-25/h3-5,7-16,27H,2,6,17-21H2,1H3,(H,32,33) |
| InChIKey | RHVKQOVGLDOZAJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|