C30H34BrNO6S — CID 22233865
3-[4-[2-[(4-bromophenoxy)carbonyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233865) has the molecular formula C30H34BrNO6S and a molecular weight of 616.57 g/mol. Its IUPAC name is 3-[4-[2-[(4-bromophenoxy)carbonyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(4-bromophenoxy)carbonyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233865 |
| Molecular Formula | C30H34BrNO6S |
| Molecular Weight | 616.57 g/mol |
| Exact Mass | 615.13 |
| IUPAC Name | 3-[4-[2-[(4-bromophenoxy)carbonyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCSc2ccccc2)C(=O)Oc2ccc(Br)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C30H34BrNO6S/c1-2-36-28(29(33)34)22-23-10-14-25(15-11-23)37-20-19-32(30(35)38-26-16-12-24(31)13-17-26)18-6-7-21-39-27-8-4-3-5-9-27/h3-5,8-17,28H,2,6-7,18-22H2,1H3,(H,33,34) |
| InChIKey | INPXGSZMJFLJDE-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.57 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|