C36H39NO7S — CID 22230495
2-ethoxy-3-[4-[2-[(4-phenoxyphenoxy)carbonyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22230495) has the molecular formula C36H39NO7S and a molecular weight of 629.78 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(4-phenoxyphenoxy)carbonyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(4-phenoxyphenoxy)carbonyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22230495 |
| Molecular Formula | C36H39NO7S |
| Molecular Weight | 629.78 g/mol |
| Exact Mass | 629.24 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(4-phenoxyphenoxy)carbonyl-(4-phenylsulfanylbutyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCSc2ccccc2)C(=O)Oc2ccc(Oc3ccccc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C36H39NO7S/c1-2-41-34(35(38)39)27-28-15-17-29(18-16-28)42-25-24-37(23-9-10-26-45-33-13-7-4-8-14-33)36(40)44-32-21-19-31(20-22-32)43-30-11-5-3-6-12-30/h3-8,11-22,34H,2,9-10,23-27H2,1H3,(H,38,39) |
| InChIKey | HQVGRAVRVNQULE-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.78 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|