C32H37F2NO8 — CID 22232738
3-[4-[2-[2-(2,2-difluorobutoxy)ethyl-(4-phenoxyphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232738) has the molecular formula C32H37F2NO8 and a molecular weight of 601.64 g/mol. Its IUPAC name is 3-[4-[2-[2-(2,2-difluorobutoxy)ethyl-(4-phenoxyphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-(2,2-difluorobutoxy)ethyl-(4-phenoxyphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232738 |
| Molecular Formula | C32H37F2NO8 |
| Molecular Weight | 601.64 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 3-[4-[2-[2-(2,2-difluorobutoxy)ethyl-(4-phenoxyphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOCC(F)(F)CC)C(=O)Oc2ccc(Oc3ccccc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C32H37F2NO8/c1-3-32(33,34)23-39-20-18-35(19-21-41-25-12-10-24(11-13-25)22-29(30(36)37)40-4-2)31(38)43-28-16-14-27(15-17-28)42-26-8-6-5-7-9-26/h5-17,29H,3-4,18-23H2,1-2H3,(H,36,37) |
| InChIKey | LUAXMDGZKPQERV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|