C32H38F2N2O7 — CID 22230324
3-[4-[2-[2-(3,3-difluorobutoxy)ethyl-[(4-phenoxyphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230324) has the molecular formula C32H38F2N2O7 and a molecular weight of 600.66 g/mol. Its IUPAC name is 3-[4-[2-[2-(3,3-difluorobutoxy)ethyl-[(4-phenoxyphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-(3,3-difluorobutoxy)ethyl-[(4-phenoxyphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230324 |
| Molecular Formula | C32H38F2N2O7 |
| Molecular Weight | 600.66 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 3-[4-[2-[2-(3,3-difluorobutoxy)ethyl-[(4-phenoxyphenyl)carbamoyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOCCC(C)(F)F)C(=O)Nc2ccc(Oc3ccccc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C32H38F2N2O7/c1-3-41-29(30(37)38)23-24-9-13-26(14-10-24)42-22-19-36(18-21-40-20-17-32(2,33)34)31(39)35-25-11-15-28(16-12-25)43-27-7-5-4-6-8-27/h4-16,29H,3,17-23H2,1-2H3,(H,35,39)(H,37,38) |
| InChIKey | OSBFXSXBCBDAAG-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|