C25H31BrF2N2O6 — CID 22231548
3-[4-[2-[(4-bromophenyl)carbamoyl-[2-(2,2-difluoropropoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22231548) has the molecular formula C25H31BrF2N2O6 and a molecular weight of 573.43 g/mol. Its IUPAC name is 3-[4-[2-[(4-bromophenyl)carbamoyl-[2-(2,2-difluoropropoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(4-bromophenyl)carbamoyl-[2-(2,2-difluoropropoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22231548 |
| Molecular Formula | C25H31BrF2N2O6 |
| Molecular Weight | 573.43 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | 3-[4-[2-[(4-bromophenyl)carbamoyl-[2-(2,2-difluoropropoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOCC(C)(F)F)C(=O)Nc2ccc(Br)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C25H31BrF2N2O6/c1-3-35-22(23(31)32)16-18-4-10-21(11-5-18)36-15-13-30(12-14-34-17-25(2,27)28)24(33)29-20-8-6-19(26)7-9-20/h4-11,22H,3,12-17H2,1-2H3,(H,29,33)(H,31,32) |
| InChIKey | GBZFBSCZGUJDIN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|