C21H32F2N2O6 — CID 22232362
3-[4-[2-[2-(2,2-difluoropropoxy)ethyl-(ethylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232362) has the molecular formula C21H32F2N2O6 and a molecular weight of 446.49 g/mol. Its IUPAC name is 3-[4-[2-[2-(2,2-difluoropropoxy)ethyl-(ethylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-(2,2-difluoropropoxy)ethyl-(ethylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232362 |
| Molecular Formula | C21H32F2N2O6 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 3-[4-[2-[2-(2,2-difluoropropoxy)ethyl-(ethylcarbamoyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCNC(=O)N(CCOCC(C)(F)F)CCOc1ccc(CC(OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C21H32F2N2O6/c1-4-24-20(28)25(10-12-29-15-21(3,22)23)11-13-31-17-8-6-16(7-9-17)14-18(19(26)27)30-5-2/h6-9,18H,4-5,10-15H2,1-3H3,(H,24,28)(H,26,27) |
| InChIKey | WBCJPRBQIPTHHP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|