C22H33F3N2O6 — CID 22232624
2-ethoxy-3-[4-[2-[propylcarbamoyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22232624) has the molecular formula C22H33F3N2O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[propylcarbamoyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[propylcarbamoyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232624 |
| Molecular Formula | C22H33F3N2O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[propylcarbamoyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCNC(=O)N(CCCOCC(F)(F)F)CCOc1ccc(CC(OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C22H33F3N2O6/c1-3-10-26-21(30)27(11-5-13-31-16-22(23,24)25)12-14-33-18-8-6-17(7-9-18)15-19(20(28)29)32-4-2/h6-9,19H,3-5,10-16H2,1-2H3,(H,26,30)(H,28,29) |
| InChIKey | GPUFQRYKVHSWEP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|