C26H36N2O6 — CID 22231026
2-ethoxy-3-[4-[2-[3-phenoxypropyl(propylcarbamoyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22231026) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[3-phenoxypropyl(propylcarbamoyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[3-phenoxypropyl(propylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231026 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[3-phenoxypropyl(propylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCNC(=O)N(CCCOc1ccccc1)CCOc1ccc(CC(OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C26H36N2O6/c1-3-15-27-26(31)28(16-8-18-33-22-9-6-5-7-10-22)17-19-34-23-13-11-21(12-14-23)20-24(25(29)30)32-4-2/h5-7,9-14,24H,3-4,8,15-20H2,1-2H3,(H,27,31)(H,29,30) |
| InChIKey | FYASWDXRYDBKST-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|