C25H42N2O5 — CID 22233652
2-ethoxy-3-[4-[2-[propylcarbamoyl(2-propylpentyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22233652) has the molecular formula C25H42N2O5 and a molecular weight of 450.62 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[propylcarbamoyl(2-propylpentyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[propylcarbamoyl(2-propylpentyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233652 |
| Molecular Formula | C25H42N2O5 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[propylcarbamoyl(2-propylpentyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCNC(=O)N(CCOc1ccc(CC(OCC)C(=O)O)cc1)CC(CCC)CCC |
| InChI | InChI=1S/C25H42N2O5/c1-5-9-21(10-6-2)19-27(25(30)26-15-7-3)16-17-32-22-13-11-20(12-14-22)18-23(24(28)29)31-8-4/h11-14,21,23H,5-10,15-19H2,1-4H3,(H,26,30)(H,28,29) |
| InChIKey | CBSPANGHKASLEA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |