C25H39F3N2O5 — CID 22231132
3-[4-[2-[butylcarbamoyl(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22231132) has the molecular formula C25H39F3N2O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is 3-[4-[2-[butylcarbamoyl(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[butylcarbamoyl(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22231132 |
| Molecular Formula | C25H39F3N2O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 3-[4-[2-[butylcarbamoyl(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCCCNC(=O)N(CCCCCCC(F)(F)F)CCOc1ccc(CC(OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C25H39F3N2O5/c1-3-5-15-29-24(33)30(16-9-7-6-8-14-25(26,27)28)17-18-35-21-12-10-20(11-13-21)19-22(23(31)32)34-4-2/h10-13,22H,3-9,14-19H2,1-2H3,(H,29,33)(H,31,32) |
| InChIKey | VWGIESNHCUEGRT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|